C22H26FN5OS — CID 55861362
5-(2-fluorophenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 55861362) has the molecular formula C22H26FN5OS and a molecular weight of 427.55 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-fluorophenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55861362 |
| Molecular Formula | C22H26FN5OS |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 5-(2-fluorophenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(N2CCCN(Cn3nc(-c4ccccc4F)n(C)c3=S)CC2)cc1 |
| InChI | InChI=1S/C22H26FN5OS/c1-25-21(19-6-3-4-7-20(19)23)24-28(22(25)30)16-26-12-5-13-27(15-14-26)17-8-10-18(29-2)11-9-17/h3-4,6-11H,5,12-16H2,1-2H3 |
| InChIKey | NIUNHMSTTCKSAR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|