C16H20Cl2N4O4S — CID 55861423
3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 55861423) has the molecular formula C16H20Cl2N4O4S and a molecular weight of 435.33 g/mol. Its IUPAC name is 3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55861423 |
| Molecular Formula | C16H20Cl2N4O4S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCN1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H20Cl2N4O4S/c17-12-3-1-4-13(18)15(12)27(25,26)21-9-7-20(8-10-21)5-2-6-22-14(23)11-19-16(22)24/h1,3-4H,2,5-11H2,(H,19,24) |
| InChIKey | IXNMTADPNQVKQD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|