C17H16F3N5O3S — CID 55861723
5-(furan-2-yl)-4-methyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-1,2,4-triazole-3-thione (PubChem CID 55861723) has the molecular formula C17H16F3N5O3S and a molecular weight of 427.41 g/mol. Its IUPAC name is 5-(furan-2-yl)-4-methyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(furan-2-yl)-4-methyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55861723 |
| Molecular Formula | C17H16F3N5O3S |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 5-(furan-2-yl)-4-methyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccco2)nn(CN(Cc2ccccc2[N+](=O)[O-])CC(F)(F)F)c1=S |
| InChI | InChI=1S/C17H16F3N5O3S/c1-22-15(14-7-4-8-28-14)21-24(16(22)29)11-23(10-17(18,19)20)9-12-5-2-3-6-13(12)25(26)27/h2-8H,9-11H2,1H3 |
| InChIKey | DLLYBYXZCCZPNH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|