C17H19F2N3O3 — CID 55862419
methyl 5-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 55862419) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is methyl 5-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55862419 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | methyl 5-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)Nc2cc(F)c(N(C)C)c(F)c2)c1C |
| InChI | InChI=1S/C17H19F2N3O3/c1-8-13(17(24)25-5)9(2)20-14(8)16(23)21-10-6-11(18)15(22(3)4)12(19)7-10/h6-7,20H,1-5H3,(H,21,23) |
| InChIKey | VQVQSHALDSPXKT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|