C22H26F4N4O2 — CID 55862893
N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 55862893) has the molecular formula C22H26F4N4O2 and a molecular weight of 454.47 g/mol. Its IUPAC name is N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55862893 |
| Molecular Formula | C22H26F4N4O2 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | CN(CCCCCc1cc(-c2ccc(F)cc2)n[nH]1)C(=O)C1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C22H26F4N4O2/c1-29(21(32)16-11-20(31)30(13-16)14-22(24,25)26)10-4-2-3-5-18-12-19(28-27-18)15-6-8-17(23)9-7-15/h6-9,12,16H,2-5,10-11,13-14H2,1H3,(H,27,28) |
| InChIKey | TZZQQSGWLOBMBC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|