C21H27NO4 — CID 55863487
3-ethoxy-4-methoxy-N-[3-(2-phenylethoxy)propyl]benzamide (PubChem CID 55863487) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-ethoxy-4-methoxy-N-[3-(2-phenylethoxy)propyl]benzamide.
| Compound Name | 3-ethoxy-4-methoxy-N-[3-(2-phenylethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55863487 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-ethoxy-4-methoxy-N-[3-(2-phenylethoxy)propyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCCOCCc2ccccc2)ccc1OC |
| InChI | InChI=1S/C21H27NO4/c1-3-26-20-16-18(10-11-19(20)24-2)21(23)22-13-7-14-25-15-12-17-8-5-4-6-9-17/h4-6,8-11,16H,3,7,12-15H2,1-2H3,(H,22,23) |
| InChIKey | GNAWRQYDSDVYTJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|