C19H21BrN2O5S — CID 55863802
2-(4-bromophenoxy)-1-[4-(2-hydroxy-5-methylphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 55863802) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-1-[4-(2-hydroxy-5-methylphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-bromophenoxy)-1-[4-(2-hydroxy-5-methylphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55863802 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 2-(4-bromophenoxy)-1-[4-(2-hydroxy-5-methylphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | Cc1ccc(O)c(S(=O)(=O)N2CCN(C(=O)COc3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C19H21BrN2O5S/c1-14-2-7-17(23)18(12-14)28(25,26)22-10-8-21(9-11-22)19(24)13-27-16-5-3-15(20)4-6-16/h2-7,12,23H,8-11,13H2,1H3 |
| InChIKey | DISXAONOXUAFSK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |