C20H24N6O3S — CID 55866037
2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(4-nitrophenyl)propanamide (PubChem CID 55866037) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(4-nitrophenyl)propanamide.
| Compound Name | 2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55866037 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(4-nitrophenyl)propanamide |
| SMILES | CCCCc1c(C)nc2nc(SC(C)C(=O)Nc3ccc([N+](=O)[O-])cc3)nn2c1C |
| InChI | InChI=1S/C20H24N6O3S/c1-5-6-7-17-12(2)21-19-23-20(24-25(19)13(17)3)30-14(4)18(27)22-15-8-10-16(11-9-15)26(28)29/h8-11,14H,5-7H2,1-4H3,(H,22,27) |
| InChIKey | HWNVCKFHEGEZFB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|