C21H20N4O2S — CID 55866076
N-[(2-hydroxyphenyl)methyl]-N,6-dimethyl-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 55866076) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)methyl]-N,6-dimethyl-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-[(2-hydroxyphenyl)methyl]-N,6-dimethyl-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55866076 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(2-hydroxyphenyl)methyl]-N,6-dimethyl-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2ccccc2O)c2cnn(Cc3cccs3)c2n1 |
| InChI | InChI=1S/C21H20N4O2S/c1-14-10-17(21(27)24(2)12-15-6-3-4-8-19(15)26)18-11-22-25(20(18)23-14)13-16-7-5-9-28-16/h3-11,26H,12-13H2,1-2H3 |
| InChIKey | PNZXCFFXQOJHSW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|