About 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol
3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol (PubChem CID 558665) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol |
| PubChem CID | 558665 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol |
| SMILES | CC=C(C)C(O)(CCN1CCCC1)C(C)=CC |
| InChI | InChI=1S/C15H27NO/c1-5-13(3)15(17,14(4)6-2)9-12-16-10-7-8-11-16/h5-6,17H,7-12H2,1-4H3 |
| InChIKey | OHMZMMKVWPLNMK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol?
The IUPAC name of 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol (CID 558665) is 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol.
What is the SMILES notation for 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol?
The canonical SMILES for 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol is CC=C(C)C(O)(CCN1CCCC1)C(C)=CC.
What is the InChIKey of 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol?
The InChIKey is OHMZMMKVWPLNMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-5-13(3)15(17,14(4)6-2)9-12-16-10-7-8-11-16/h5-6,17H,7-12H2,1-4H3.
What are the key properties of 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol?
3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol has a molecular weight of 237.39 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol is sourced from PubChem (CID 558665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).