C23H24N4O5 — CID 55866900
ethyl 4-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate (PubChem CID 55866900) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is ethyl 4-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55866900 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | ethyl 4-[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)cc1OCC(=O)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C23H24N4O5/c1-4-31-23(30)21-19(14-27(25-21)18-11-6-5-7-12-18)32-15-20(28)24-17-10-8-9-16(13-17)22(29)26(2)3/h5-14H,4,15H2,1-3H3,(H,24,28) |
| InChIKey | QXGYZSZBCHXGGB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |