C16H18F3N3O3 — CID 55868014
4,4,4-trifluoro-3-hydroxy-N-[(2-hydroxyphenyl)methyl]-N-methyl-3-(1-methylimidazol-2-yl)butanamide (PubChem CID 55868014) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-N-[(2-hydroxyphenyl)methyl]-N-methyl-3-(1-methylimidazol-2-yl)butanamide.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-N-[(2-hydroxyphenyl)methyl]-N-methyl-3-(1-methylimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 55868014 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-N-[(2-hydroxyphenyl)methyl]-N-methyl-3-(1-methylimidazol-2-yl)butanamide |
| SMILES | CN(Cc1ccccc1O)C(=O)CC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O3/c1-21-8-7-20-14(21)15(25,16(17,18)19)9-13(24)22(2)10-11-5-3-4-6-12(11)23/h3-8,23,25H,9-10H2,1-2H3 |
| InChIKey | WHSMRHFCPAVBAZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|