C23H25FN4O — CID 55868469
1-(2-fluorophenyl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]pyrazole-3-carboxamide (PubChem CID 55868469) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55868469 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]pyrazole-3-carboxamide |
| SMILES | CC1CCCCN1Cc1ccc(NC(=O)c2ccn(-c3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C23H25FN4O/c1-17-6-4-5-14-27(17)16-18-9-11-19(12-10-18)25-23(29)21-13-15-28(26-21)22-8-3-2-7-20(22)24/h2-3,7-13,15,17H,4-6,14,16H2,1H3,(H,25,29) |
| InChIKey | ISSLMESDOVRNDF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |