C27H26N4O3 — CID 55869482
3-(3,4-dimethylphenyl)-N-[2-[(4-hydroxybenzoyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 55869482) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-[2-[(4-hydroxybenzoyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-[2-[(4-hydroxybenzoyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55869482 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-[2-[(4-hydroxybenzoyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NCCNC(=O)c2ccc(O)cc2)cc1C |
| InChI | InChI=1S/C27H26N4O3/c1-18-8-9-21(16-19(18)2)25-24(17-31(30-25)22-6-4-3-5-7-22)27(34)29-15-14-28-26(33)20-10-12-23(32)13-11-20/h3-13,16-17,32H,14-15H2,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | SWBJLFCLYLECMI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|