C23H23N3O3S — CID 55870004
2-(2,4-dimethylphenyl)sulfanyl-N-[2-[(4-hydroxybenzoyl)amino]ethyl]pyridine-3-carboxamide (PubChem CID 55870004) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfanyl-N-[2-[(4-hydroxybenzoyl)amino]ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)sulfanyl-N-[2-[(4-hydroxybenzoyl)amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55870004 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfanyl-N-[2-[(4-hydroxybenzoyl)amino]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(Sc2ncccc2C(=O)NCCNC(=O)c2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-15-5-10-20(16(2)14-15)30-23-19(4-3-11-26-23)22(29)25-13-12-24-21(28)17-6-8-18(27)9-7-17/h3-11,14,27H,12-13H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | DBKXVFQPQYYMAN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|