C21H26N4O3 — CID 55870064
N-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-4-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 55870064) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-4-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-4-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 55870064 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[4-[2-(dimethylamino)-2-oxoethyl]phenyl]-4-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)NC(=O)Nc1ccc(C(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-14(2)22-21(28)24-18-11-7-16(8-12-18)20(27)23-17-9-5-15(6-10-17)13-19(26)25(3)4/h5-12,14H,13H2,1-4H3,(H,23,27)(H2,22,24,28) |
| InChIKey | NPCLXNGICCVFPN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |