C18H20Cl4N4 — CID 558705
4-(4-chlorophenyl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)pyrimidin-2-amine (PubChem CID 558705) has the molecular formula C18H20Cl4N4 and a molecular weight of 434.20 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 558705 |
| Molecular Formula | C18H20Cl4N4 |
| Molecular Weight | 434.20 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)pyrimidin-2-amine |
| SMILES | CN1CCCC1CCNc1nc(-c2ccc(Cl)cc2)cc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C18H20Cl4N4/c1-26-10-2-3-14(26)8-9-23-17-24-15(11-16(25-17)18(20,21)22)12-4-6-13(19)7-5-12/h4-7,11,14H,2-3,8-10H2,1H3,(H,23,24,25) |
| InChIKey | UFRNMLHSZHUVRR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.20 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|