C19H27FN2O3 — CID 55870530
1-butanoyl-N-[2-(4-fluorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55870530) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-butanoyl-N-[2-(4-fluorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-butanoyl-N-[2-(4-fluorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55870530 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-butanoyl-N-[2-(4-fluorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCC(=O)N1CCC(C(=O)N(C)CCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN2O3/c1-3-4-18(23)22-11-9-15(10-12-22)19(24)21(2)13-14-25-17-7-5-16(20)6-8-17/h5-8,15H,3-4,9-14H2,1-2H3 |
| InChIKey | YGLOXSXGCSFSLM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |