C22H21ClN2O4 — CID 55871580
ethyl 3-[4-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoate (PubChem CID 55871580) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is ethyl 3-[4-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55871580 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | ethyl 3-[4-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(NC(=O)C2CC(=O)N(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-2-29-21(27)12-5-15-3-8-18(9-4-15)24-22(28)16-13-20(26)25(14-16)19-10-6-17(23)7-11-19/h3-12,16H,2,13-14H2,1H3,(H,24,28) |
| InChIKey | FSFLDGPIPCVBPR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|