C17H15ClINO3S — CID 55874081
(4-chloro-2-iodophenyl)-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 55874081) has the molecular formula C17H15ClINO3S and a molecular weight of 475.74 g/mol. Its IUPAC name is (4-chloro-2-iodophenyl)-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (4-chloro-2-iodophenyl)-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 55874081 |
| Molecular Formula | C17H15ClINO3S |
| Molecular Weight | 475.74 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | (4-chloro-2-iodophenyl)-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C17H15ClINO3S/c1-24(22,23)13-5-7-16-11(9-13)3-2-8-20(16)17(21)14-6-4-12(18)10-15(14)19/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | HNLSXUMKKXPCRY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|