C25H32N2O3S — CID 55876771
[3-(2-methylpiperidin-1-yl)sulfonylphenyl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone (PubChem CID 55876771) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is [3-(2-methylpiperidin-1-yl)sulfonylphenyl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [3-(2-methylpiperidin-1-yl)sulfonylphenyl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 55876771 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [3-(2-methylpiperidin-1-yl)sulfonylphenyl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)N2CCCC2CCc2ccccc2)c1 |
| InChI | InChI=1S/C25H32N2O3S/c1-20-9-5-6-18-27(20)31(29,30)24-14-7-12-22(19-24)25(28)26-17-8-13-23(26)16-15-21-10-3-2-4-11-21/h2-4,7,10-12,14,19-20,23H,5-6,8-9,13,15-18H2,1H3 |
| InChIKey | XEBGDIOUFGHPND-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |