C22H24N2O4 — CID 55876805
ethyl 3-[[2-(1H-indol-3-yl)acetyl]amino]-3-(3-methoxyphenyl)propanoate (PubChem CID 55876805) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is ethyl 3-[[2-(1H-indol-3-yl)acetyl]amino]-3-(3-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[[2-(1H-indol-3-yl)acetyl]amino]-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55876805 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl 3-[[2-(1H-indol-3-yl)acetyl]amino]-3-(3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)Cc1c[nH]c2ccccc12)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-3-28-22(26)13-20(15-7-6-8-17(11-15)27-2)24-21(25)12-16-14-23-19-10-5-4-9-18(16)19/h4-11,14,20,23H,3,12-13H2,1-2H3,(H,24,25) |
| InChIKey | CJDALKLTANOJSM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |