C22H24ClN5O2 — CID 55877622
6-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-2-(2,5-dimethylphenyl)-4,5-dihydropyridazin-3-one (PubChem CID 55877622) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 6-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-2-(2,5-dimethylphenyl)-4,5-dihydropyridazin-3-one.
| Compound Name | 6-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-2-(2,5-dimethylphenyl)-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 55877622 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 6-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-2-(2,5-dimethylphenyl)-4,5-dihydropyridazin-3-one |
| SMILES | Cc1ccc(C)c(N2N=C(C(=O)N3CCN(c4cccc(Cl)n4)CC3)CCC2=O)c1 |
| InChI | InChI=1S/C22H24ClN5O2/c1-15-6-7-16(2)18(14-15)28-21(29)9-8-17(25-28)22(30)27-12-10-26(11-13-27)20-5-3-4-19(23)24-20/h3-7,14H,8-13H2,1-2H3 |
| InChIKey | JMHVWUHVRHPLGV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|