C20H19ClN4O3S — CID 55877767
2-chloro-N-(2-methoxyethyl)-4-[[2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetyl]amino]benzamide (PubChem CID 55877767) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55877767 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetyl]amino]benzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)Cc2csc(-c3ccccn3)n2)cc1Cl |
| InChI | InChI=1S/C20H19ClN4O3S/c1-28-9-8-23-19(27)15-6-5-13(10-16(15)21)24-18(26)11-14-12-29-20(25-14)17-4-2-3-7-22-17/h2-7,10,12H,8-9,11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | IJXPWXHFWDHYBN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|