C26H27N3O5S — CID 55878258
N-[1-(3-nitrophenyl)ethyl]-3-(2-oxo-2-piperidin-1-ylethoxy)-5-phenylthiophene-2-carboxamide (PubChem CID 55878258) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[1-(3-nitrophenyl)ethyl]-3-(2-oxo-2-piperidin-1-ylethoxy)-5-phenylthiophene-2-carboxamide.
| Compound Name | N-[1-(3-nitrophenyl)ethyl]-3-(2-oxo-2-piperidin-1-ylethoxy)-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55878258 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[1-(3-nitrophenyl)ethyl]-3-(2-oxo-2-piperidin-1-ylethoxy)-5-phenylthiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1sc(-c2ccccc2)cc1OCC(=O)N1CCCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27N3O5S/c1-18(20-11-8-12-21(15-20)29(32)33)27-26(31)25-22(16-23(35-25)19-9-4-2-5-10-19)34-17-24(30)28-13-6-3-7-14-28/h2,4-5,8-12,15-16,18H,3,6-7,13-14,17H2,1H3,(H,27,31) |
| InChIKey | JGOHRGCZRBLBHH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|