C15H15N3O6S — CID 55880156
N-[3-[(2-methoxy-4-nitrophenyl)sulfonylamino]phenyl]acetamide (PubChem CID 55880156) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is N-[3-[(2-methoxy-4-nitrophenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | N-[3-[(2-methoxy-4-nitrophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 55880156 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[3-[(2-methoxy-4-nitrophenyl)sulfonylamino]phenyl]acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)Nc1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C15H15N3O6S/c1-10(19)16-11-4-3-5-12(8-11)17-25(22,23)15-7-6-13(18(20)21)9-14(15)24-2/h3-9,17H,1-2H3,(H,16,19) |
| InChIKey | KUKWFXCKVDGPIS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|