C19H22N4O3S — CID 55880244
N-[4-[2-[3-(3-cyanopropoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide (PubChem CID 55880244) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[4-[2-[3-(3-cyanopropoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[4-[2-[3-(3-cyanopropoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55880244 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-[2-[3-(3-cyanopropoxy)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc(CC(=O)Nc2cccc(OCCCC#N)c2)cs1 |
| InChI | InChI=1S/C19H22N4O3S/c1-13(2)18(25)23-19-22-15(12-27-19)11-17(24)21-14-6-5-7-16(10-14)26-9-4-3-8-20/h5-7,10,12-13H,3-4,9,11H2,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | UVRLVNKOZJSUGW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|