C24H23ClN6O2 — CID 55880730
(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]prop-2-enamide (PubChem CID 55880730) has the molecular formula C24H23ClN6O2 and a molecular weight of 462.94 g/mol. Its IUPAC name is (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55880730 |
| Molecular Formula | C24H23ClN6O2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)Nc1cccc(OCCn2cncn2)c1 |
| InChI | InChI=1S/C24H23ClN6O2/c1-18-22(24(25)31(29-18)15-19-6-3-2-4-7-19)10-11-23(32)28-20-8-5-9-21(14-20)33-13-12-30-17-26-16-27-30/h2-11,14,16-17H,12-13,15H2,1H3,(H,28,32)/b11-10+ |
| InChIKey | BTZIYKQFWXUACG-ZHACJKMWSA-N |
| XLogP | 4.22 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|