About 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one
3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one (PubChem CID 55881647) has the molecular formula C21H20FNO3
and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one.
Molecular Properties
| Compound Name | 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one |
| PubChem CID | 55881647 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one |
| SMILES | Cc1cc(F)c2c(c1)CCCN2C(=O)C1(C)Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C21H20FNO3/c1-13-10-14-7-5-9-23(18(14)17(22)11-13)20(25)21(2)12-15-6-3-4-8-16(15)19(24)26-21/h3-4,6,8,10-11H,5,7,9,12H2,1-2H3 |
| InChIKey | DKEOMSXOGRJAGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
The IUPAC name of 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one (CID 55881647) is 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one.
What is the SMILES notation for 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
The canonical SMILES for 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one is Cc1cc(F)c2c(c1)CCCN2C(=O)C1(C)Cc2ccccc2C(=O)O1.
What is the InChIKey of 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
The InChIKey is DKEOMSXOGRJAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FNO3/c1-13-10-14-7-5-9-23(18(14)17(22)11-13)20(25)21(2)12-15-6-3-4-8-16(15)19(24)26-21/h3-4,6,8,10-11H,5,7,9,12H2,1-2H3.
What are the key properties of 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one?
3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one has a molecular weight of 353.39 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-fluoro-6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-4H-isochromen-1-one is sourced from PubChem (CID 55881647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).