C23H25N3O3 — CID 55882454
3-(cyclopropylcarbamoylamino)-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N-methylbenzamide (PubChem CID 55882454) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(cyclopropylcarbamoylamino)-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N-methylbenzamide.
| Compound Name | 3-(cyclopropylcarbamoylamino)-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55882454 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-(cyclopropylcarbamoylamino)-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N-methylbenzamide |
| SMILES | CCc1oc2ccccc2c1CN(C)C(=O)c1cccc(NC(=O)NC2CC2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-3-20-19(18-9-4-5-10-21(18)29-20)14-26(2)22(27)15-7-6-8-17(13-15)25-23(28)24-16-11-12-16/h4-10,13,16H,3,11-12,14H2,1-2H3,(H2,24,25,28) |
| InChIKey | XQJKLUDLZPVUHK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |