C19H28N4O3S — CID 55882670
2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylbutoxy)ethyl]acetamide (PubChem CID 55882670) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylbutoxy)ethyl]acetamide.
| Compound Name | 2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylbutoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55882670 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(3-methylbutoxy)ethyl]acetamide |
| SMILES | CC(C)CCOCCNC(=O)CSc1nnc(C2CC2)n1Cc1ccco1 |
| InChI | InChI=1S/C19H28N4O3S/c1-14(2)7-10-25-11-8-20-17(24)13-27-19-22-21-18(15-5-6-15)23(19)12-16-4-3-9-26-16/h3-4,9,14-15H,5-8,10-13H2,1-2H3,(H,20,24) |
| InChIKey | YNJREGCAZDWGTC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|