C23H22N2O5 — CID 55883594
3-[4-[(E)-3-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]propanoic acid (PubChem CID 55883594) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-[4-[(E)-3-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-3-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 55883594 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[4-[(E)-3-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]propanoic acid |
| SMILES | Cn1ccnc1COc1ccc(C(=O)/C=C/c2ccc(OCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O5/c1-25-14-13-24-22(25)16-30-20-9-5-18(6-10-20)21(26)11-4-17-2-7-19(8-3-17)29-15-12-23(27)28/h2-11,13-14H,12,15-16H2,1H3,(H,27,28)/b11-4+ |
| InChIKey | OPTZEFNGQCZDAP-NYYWCZLTSA-N |
| XLogP | 3.75 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|