C23H21ClN6OS — CID 55884661
2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide (PubChem CID 55884661) has the molecular formula C23H21ClN6OS and a molecular weight of 464.98 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide.
| Compound Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55884661 |
| Molecular Formula | C23H21ClN6OS |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1cccc(Cl)c1)Nc1cccc(-c2cn3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C23H21ClN6OS/c24-17-6-4-8-19(12-17)30-15-25-28-23(30)32-14-22(31)26-18-7-3-5-16(11-18)20-13-29-10-2-1-9-21(29)27-20/h3-8,11-13,15H,1-2,9-10,14H2,(H,26,31) |
| InChIKey | YMSXUXYRXWWSLR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |