C21H27ClN4O3 — CID 55885276
N-(3-chloro-4-piperidin-1-ylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55885276) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is N-(3-chloro-4-piperidin-1-ylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(3-chloro-4-piperidin-1-ylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55885276 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(3-chloro-4-piperidin-1-ylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)Nc1ccc(N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C21H27ClN4O3/c22-16-13-15(7-8-17(16)25-11-5-2-6-12-25)23-18(27)14-26-19(28)21(24-20(26)29)9-3-1-4-10-21/h7-8,13H,1-6,9-12,14H2,(H,23,27)(H,24,29) |
| InChIKey | OKPJTYJIRDQQJN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|