C23H20N4O3 — CID 55886358
2-(1,3-dioxoisoindol-2-yl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide (PubChem CID 55886358) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55886358 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc(-c2cn3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C23H20N4O3/c28-21(14-27-22(29)17-5-1-2-6-18(17)23(27)30)24-16-10-8-15(9-11-16)19-13-26-12-4-3-7-20(26)25-19/h1-2,5-6,8-11,13H,3-4,7,12,14H2,(H,24,28) |
| InChIKey | RGJSVUGEYVBTHC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|