About N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide
N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 55886737) has the molecular formula C22H21BrN2O2
and a molecular weight of 425.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide |
| PubChem CID | 55886737 |
| Molecular Formula | C22H21BrN2O2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)N(Cc2ccccn2)c2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C22H21BrN2O2/c1-16-6-11-21(17(2)13-16)27-15-22(26)25(14-19-5-3-4-12-24-19)20-9-7-18(23)8-10-20/h3-13H,14-15H2,1-2H3 |
| InChIKey | HNLQHAUBHNFOLC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide?
The IUPAC name of N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide (CID 55886737) is N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide.
What is the SMILES notation for N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide?
The canonical SMILES for N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide is Cc1ccc(OCC(=O)N(Cc2ccccn2)c2ccc(Br)cc2)c(C)c1.
What is the InChIKey of N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide?
The InChIKey is HNLQHAUBHNFOLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BrN2O2/c1-16-6-11-21(17(2)13-16)27-15-22(26)25(14-19-5-3-4-12-24-19)20-9-7-18(23)8-10-20/h3-13H,14-15H2,1-2H3.
What are the key properties of N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide?
N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide has a molecular weight of 425.33 g/mol, XLogP of 5.07, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2-(2,4-dimethylphenoxy)-N-(pyridin-2-ylmethyl)acetamide is sourced from PubChem (CID 55886737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).