2-(bromomethyl)prop-2-enoic acid

C4H5BrO2 — CID 558884

IUPAC2-(bromomethyl)prop-2-enoic acid
SMILESC=C(CBr)C(=O)O
InChIInChI=1S/C4H5BrO2/c1-3(2-5)4(6)7/h1-2H2,(H,6,7)
InChIKeyNOOYFQLPKUQDNE-UHFFFAOYSA-N
MW164.99 g/mol
LogP1.02
Rot. Bonds2

About 2-(bromomethyl)prop-2-enoic acid

2-(bromomethyl)prop-2-enoic acid (PubChem CID 558884) has the molecular formula C4H5BrO2 and a molecular weight of 164.99 g/mol. Its IUPAC name is 2-(bromomethyl)prop-2-enoic acid.

Molecular Properties

Compound Name2-(bromomethyl)prop-2-enoic acid
PubChem CID558884
Molecular FormulaC4H5BrO2
Molecular Weight164.99 g/mol
Exact Mass163.95
IUPAC Name2-(bromomethyl)prop-2-enoic acid
SMILESC=C(CBr)C(=O)O
InChIInChI=1S/C4H5BrO2/c1-3(2-5)4(6)7/h1-2H2,(H,6,7)
InChIKeyNOOYFQLPKUQDNE-UHFFFAOYSA-N
XLogP1.02
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.99
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(bromomethyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(bromomethyl)prop-2-enoic acid?
The IUPAC name of 2-(bromomethyl)prop-2-enoic acid (CID 558884) is 2-(bromomethyl)prop-2-enoic acid.
What is the SMILES notation for 2-(bromomethyl)prop-2-enoic acid?
The canonical SMILES for 2-(bromomethyl)prop-2-enoic acid is C=C(CBr)C(=O)O.
What is the InChIKey of 2-(bromomethyl)prop-2-enoic acid?
The InChIKey is NOOYFQLPKUQDNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrO2/c1-3(2-5)4(6)7/h1-2H2,(H,6,7).
What are the key properties of 2-(bromomethyl)prop-2-enoic acid?
2-(bromomethyl)prop-2-enoic acid has a molecular weight of 164.99 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)prop-2-enoic acid is sourced from PubChem (CID 558884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).