C22H21ClFN3O2 — CID 55890052
3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 55890052) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55890052 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(Cl)cc2)o1)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C22H21ClFN3O2/c23-16-5-3-15(4-6-16)20-14-25-22(29-20)10-9-21(28)26-17-7-8-19(18(24)13-17)27-11-1-2-12-27/h3-8,13-14H,1-2,9-12H2,(H,26,28) |
| InChIKey | VZNDTVAQZBRWMW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|