About 2-methyl-5-pentyloxolane
2-methyl-5-pentyloxolane (PubChem CID 558919) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-methyl-5-pentyloxolane.
Molecular Properties
| Compound Name | 2-methyl-5-pentyloxolane |
| PubChem CID | 558919 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 2-methyl-5-pentyloxolane |
| SMILES | CCCCCC1CCC(C)O1 |
| InChI | InChI=1S/C10H20O/c1-3-4-5-6-10-8-7-9(2)11-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | YXBVLMCHNUHELZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-pentyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-pentyloxolane?
The IUPAC name of 2-methyl-5-pentyloxolane (CID 558919) is 2-methyl-5-pentyloxolane.
What is the SMILES notation for 2-methyl-5-pentyloxolane?
The canonical SMILES for 2-methyl-5-pentyloxolane is CCCCCC1CCC(C)O1.
What is the InChIKey of 2-methyl-5-pentyloxolane?
The InChIKey is YXBVLMCHNUHELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-3-4-5-6-10-8-7-9(2)11-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 2-methyl-5-pentyloxolane?
2-methyl-5-pentyloxolane has a molecular weight of 156.27 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-pentyloxolane is sourced from PubChem (CID 558919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).