C18H16BrFN4O3S — CID 55892273
2-[(4-bromophenyl)sulfonyl-methylamino]-N-(3-fluoro-4-pyrazol-1-ylphenyl)acetamide (PubChem CID 55892273) has the molecular formula C18H16BrFN4O3S and a molecular weight of 467.32 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(3-fluoro-4-pyrazol-1-ylphenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(3-fluoro-4-pyrazol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55892273 |
| Molecular Formula | C18H16BrFN4O3S |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(3-fluoro-4-pyrazol-1-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(-n2cccn2)c(F)c1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrFN4O3S/c1-23(28(26,27)15-6-3-13(19)4-7-15)12-18(25)22-14-5-8-17(16(20)11-14)24-10-2-9-21-24/h2-11H,12H2,1H3,(H,22,25) |
| InChIKey | HIUKXDJHZSRTME-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |