C17H27N3O5S — CID 55892850
4-[methoxy(methyl)sulfamoyl]-N-[2-oxo-2-(propylamino)ethyl]-N-propylbenzamide (PubChem CID 55892850) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-[methoxy(methyl)sulfamoyl]-N-[2-oxo-2-(propylamino)ethyl]-N-propylbenzamide.
| Compound Name | 4-[methoxy(methyl)sulfamoyl]-N-[2-oxo-2-(propylamino)ethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 55892850 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[methoxy(methyl)sulfamoyl]-N-[2-oxo-2-(propylamino)ethyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)CN(CCC)C(=O)c1ccc(S(=O)(=O)N(C)OC)cc1 |
| InChI | InChI=1S/C17H27N3O5S/c1-5-11-18-16(21)13-20(12-6-2)17(22)14-7-9-15(10-8-14)26(23,24)19(3)25-4/h7-10H,5-6,11-13H2,1-4H3,(H,18,21) |
| InChIKey | VMXSAZZTWYXIRI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|