C20H27N3O5S2 — CID 55893509
N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-3-(propan-2-ylsulfamoyl)benzamide (PubChem CID 55893509) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-3-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-3-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55893509 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-3-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(C(=O)NC(C)c2ccc(S(=O)(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C20H27N3O5S2/c1-14(2)22-29(25,26)19-8-6-7-17(13-19)20(24)21-15(3)16-9-11-18(12-10-16)30(27,28)23(4)5/h6-15,22H,1-5H3,(H,21,24) |
| InChIKey | DZMSLSLWZMPOFK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |