C14H22N2O5S2 — CID 55896392
2-methylsulfonyl-N-(1-morpholin-4-ylpropan-2-yl)benzenesulfonamide (PubChem CID 55896392) has the molecular formula C14H22N2O5S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-methylsulfonyl-N-(1-morpholin-4-ylpropan-2-yl)benzenesulfonamide.
| Compound Name | 2-methylsulfonyl-N-(1-morpholin-4-ylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55896392 |
| Molecular Formula | C14H22N2O5S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-methylsulfonyl-N-(1-morpholin-4-ylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(CN1CCOCC1)NS(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O5S2/c1-12(11-16-7-9-21-10-8-16)15-23(19,20)14-6-4-3-5-13(14)22(2,17)18/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | AHUVYKQYAKIEGM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |