C21H25ClN2O4S — CID 55896659
N-(5-chloro-2-propoxyphenyl)-3-(cyclopentylsulfamoyl)benzamide (PubChem CID 55896659) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is N-(5-chloro-2-propoxyphenyl)-3-(cyclopentylsulfamoyl)benzamide.
| Compound Name | N-(5-chloro-2-propoxyphenyl)-3-(cyclopentylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55896659 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-(5-chloro-2-propoxyphenyl)-3-(cyclopentylsulfamoyl)benzamide |
| SMILES | CCCOc1ccc(Cl)cc1NC(=O)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C21H25ClN2O4S/c1-2-12-28-20-11-10-16(22)14-19(20)23-21(25)15-6-5-9-18(13-15)29(26,27)24-17-7-3-4-8-17/h5-6,9-11,13-14,17,24H,2-4,7-8,12H2,1H3,(H,23,25) |
| InChIKey | FJERACOQLUVECL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |