C20H21Cl2N3O2 — CID 55897278
N-[(4-chlorophenyl)methyl]-2-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]acetamide (PubChem CID 55897278) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 55897278 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1C(=O)N1CCCC1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c21-15-5-3-14(4-6-15)12-24-19(26)13-23-18-8-7-16(22)11-17(18)20(27)25-9-1-2-10-25/h3-8,11,23H,1-2,9-10,12-13H2,(H,24,26) |
| InChIKey | WXJRHJJIKQYTMF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |