C23H29N3O2 — CID 55898202
N-[3-[[2-(4-tert-butylanilino)-2-oxoethyl]amino]-4-methylphenyl]cyclopropanecarboxamide (PubChem CID 55898202) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[3-[[2-(4-tert-butylanilino)-2-oxoethyl]amino]-4-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[2-(4-tert-butylanilino)-2-oxoethyl]amino]-4-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55898202 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[3-[[2-(4-tert-butylanilino)-2-oxoethyl]amino]-4-methylphenyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC2)cc1NCC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-15-5-10-19(26-22(28)16-6-7-16)13-20(15)24-14-21(27)25-18-11-8-17(9-12-18)23(2,3)4/h5,8-13,16,24H,6-7,14H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | LCSCLFALPRQQJS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |