About 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide
2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide (PubChem CID 55898468) has the molecular formula C18H16F3N3O3
and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide |
| PubChem CID | 55898468 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CNc2ccc(OCC(F)(F)F)c(C#N)c2)c1 |
| InChI | InChI=1S/C18H16F3N3O3/c1-26-15-4-2-3-14(8-15)24-17(25)10-23-13-5-6-16(12(7-13)9-22)27-11-18(19,20)21/h2-8,23H,10-11H2,1H3,(H,24,25) |
| InChIKey | BVOFFKIPWIZUFG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide?
The IUPAC name of 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide (CID 55898468) is 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide.
What is the SMILES notation for 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide?
The canonical SMILES for 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide is COc1cccc(NC(=O)CNc2ccc(OCC(F)(F)F)c(C#N)c2)c1.
What is the InChIKey of 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide?
The InChIKey is BVOFFKIPWIZUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3N3O3/c1-26-15-4-2-3-14(8-15)24-17(25)10-23-13-5-6-16(12(7-13)9-22)27-11-18(19,20)21/h2-8,23H,10-11H2,1H3,(H,24,25).
What are the key properties of 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide?
2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide has a molecular weight of 379.34 g/mol, XLogP of 3.56, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-(3-methoxyphenyl)acetamide is sourced from PubChem (CID 55898468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).