C18H18Cl2N2O2 — CID 55898935
3,5-dichloro-N-[2-(morpholin-4-ylmethyl)phenyl]benzamide (PubChem CID 55898935) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(morpholin-4-ylmethyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-(morpholin-4-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55898935 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3,5-dichloro-N-[2-(morpholin-4-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1CN1CCOCC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-15-9-14(10-16(20)11-15)18(23)21-17-4-2-1-3-13(17)12-22-5-7-24-8-6-22/h1-4,9-11H,5-8,12H2,(H,21,23) |
| InChIKey | WKZMLPLNRBHDTL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |