C20H19N3O4S — CID 55900515
2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[(4-nitrophenyl)methyl]acetamide (PubChem CID 55900515) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[(4-nitrophenyl)methyl]acetamide.
| Compound Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[(4-nitrophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55900515 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[(4-nitrophenyl)methyl]acetamide |
| SMILES | CCOc1ccccc1-c1nc(CC(=O)NCc2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C20H19N3O4S/c1-2-27-18-6-4-3-5-17(18)20-22-15(13-28-20)11-19(24)21-12-14-7-9-16(10-8-14)23(25)26/h3-10,13H,2,11-12H2,1H3,(H,21,24) |
| InChIKey | ISLHFUYUAHASEW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|