About 2-benzylpiperazine
2-benzylpiperazine (PubChem CID 559033) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-benzylpiperazine.
Molecular Properties
| Compound Name | 2-benzylpiperazine |
| PubChem CID | 559033 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-benzylpiperazine |
| SMILES | c1ccc(CC2CNCCN2)cc1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h1-5,11-13H,6-9H2 |
| InChIKey | RITMXTLCKYLIKW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpiperazine?
The IUPAC name of 2-benzylpiperazine (CID 559033) is 2-benzylpiperazine.
What is the SMILES notation for 2-benzylpiperazine?
The canonical SMILES for 2-benzylpiperazine is c1ccc(CC2CNCCN2)cc1.
What is the InChIKey of 2-benzylpiperazine?
The InChIKey is RITMXTLCKYLIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h1-5,11-13H,6-9H2.
What are the key properties of 2-benzylpiperazine?
2-benzylpiperazine has a molecular weight of 176.26 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpiperazine is sourced from PubChem (CID 559033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).